C10H11NO5S2 — CID 90081202
N-(3,4-dihydroxy-5-thiophen-2-ylfuran-2-yl)ethanesulfonamide (PubChem CID 90081202) has the molecular formula C10H11NO5S2 and a molecular weight of 289.33 g/mol. Its IUPAC name is N-(3,4-dihydroxy-5-thiophen-2-ylfuran-2-yl)ethanesulfonamide.
| Compound Name | N-(3,4-dihydroxy-5-thiophen-2-ylfuran-2-yl)ethanesulfonamide |
|---|---|
| PubChem CID | 90081202 |
| Molecular Formula | C10H11NO5S2 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | N-(3,4-dihydroxy-5-thiophen-2-ylfuran-2-yl)ethanesulfonamide |
| SMILES | CCS(=O)(=O)Nc1oc(-c2cccs2)c(O)c1O |
| InChI | InChI=1S/C10H11NO5S2/c1-2-18(14,15)11-10-8(13)7(12)9(16-10)6-4-3-5-17-6/h3-5,11-13H,2H2,1H3 |
| InChIKey | SUNGVFFHITVRRC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |