C15H23N2O9P2+ — CID 90087145
[3-[3-(5-formyl-2-nitrophenoxy)propyl-methylamino]-1-hydroxy-1-[hydroxy(methyl)phosphoryl]propyl]-hydroxy-oxophosphanium (PubChem CID 90087145) has the molecular formula C15H23N2O9P2+ and a molecular weight of 437.30 g/mol. Its IUPAC name is [3-[3-(5-formyl-2-nitrophenoxy)propyl-methylamino]-1-hydroxy-1-[hydroxy(methyl)phosphoryl]propyl]-hydroxy-oxophosphanium.
| Compound Name | [3-[3-(5-formyl-2-nitrophenoxy)propyl-methylamino]-1-hydroxy-1-[hydroxy(methyl)phosphoryl]propyl]-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 90087145 |
| Molecular Formula | C15H23N2O9P2+ |
| Molecular Weight | 437.30 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | [3-[3-(5-formyl-2-nitrophenoxy)propyl-methylamino]-1-hydroxy-1-[hydroxy(methyl)phosphoryl]propyl]-hydroxy-oxophosphanium |
| SMILES | CN(CCCOc1cc(C=O)ccc1[N+](=O)[O-])CCC(O)([P+](=O)O)P(C)(=O)O |
| InChI | InChI=1S/C15H22N2O9P2/c1-16(8-6-15(19,27(22)23)28(2,24)25)7-3-9-26-14-10-12(11-18)4-5-13(14)17(20)21/h4-5,10-11,19H,3,6-9H2,1-2H3,(H-,22,23,24,25)/p+1 |
| InChIKey | VTYSVYDOHQVJMW-UHFFFAOYSA-O |
| XLogP | 1.78 |
| TPSA | 167.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.30 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|