C33H35N4O11P2+ — CID 90087126
hydroxy-[1-hydroxy-3-[methyl-[3-[2-nitro-5-[(E)-[[2-(pyren-1-ylmethoxy)acetyl]hydrazinylidene]methyl]phenoxy]propyl]amino]-1-phosphonopropyl]-oxophosphanium (PubChem CID 90087126) has the molecular formula C33H35N4O11P2+ and a molecular weight of 725.61 g/mol. Its IUPAC name is hydroxy-[1-hydroxy-3-[methyl-[3-[2-nitro-5-[(E)-[[2-(pyren-1-ylmethoxy)acetyl]hydrazinylidene]methyl]phenoxy]propyl]amino]-1-phosphonopropyl]-oxophosphanium.
| Compound Name | hydroxy-[1-hydroxy-3-[methyl-[3-[2-nitro-5-[(E)-[[2-(pyren-1-ylmethoxy)acetyl]hydrazinylidene]methyl]phenoxy]propyl]amino]-1-phosphonopropyl]-oxophosphanium |
|---|---|
| PubChem CID | 90087126 |
| Molecular Formula | C33H35N4O11P2+ |
| Molecular Weight | 725.61 g/mol |
| Exact Mass | 725.18 |
| IUPAC Name | hydroxy-[1-hydroxy-3-[methyl-[3-[2-nitro-5-[(E)-[[2-(pyren-1-ylmethoxy)acetyl]hydrazinylidene]methyl]phenoxy]propyl]amino]-1-phosphonopropyl]-oxophosphanium |
| SMILES | CN(CCCOc1cc(/C=N/NC(=O)COCc2ccc3ccc4cccc5ccc2c3c45)ccc1[N+](=O)[O-])CCC(O)([P+](=O)O)P(=O)(O)O |
| InChI | InChI=1S/C33H34N4O11P2/c1-36(16-14-33(39,49(42)43)50(44,45)46)15-3-17-48-29-18-22(6-13-28(29)37(40)41)19-34-35-30(38)21-47-20-26-10-9-25-8-7-23-4-2-5-24-11-12-27(26)32(25)31(23)24/h2,4-13,18-19,39H,3,14-17,20-21H2,1H3,(H3-,35,38,42,43,44,45,46)/p+1/b34-19+ |
| InChIKey | QSENIWJSPZICJL-ALQBTCKLSA-O |
| XLogP | 4.81 |
| TPSA | 221.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.61 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|