C33H37N3O10P2 — CID 90089164
[1-hydroxy-3-[methyl-[3-[3-[(E)-[[2-(pyren-1-ylmethoxy)acetyl]hydrazinylidene]methyl]phenoxy]propyl]amino]-1-phosphonopropyl]phosphonic acid (PubChem CID 90089164) has the molecular formula C33H37N3O10P2 and a molecular weight of 697.62 g/mol. Its IUPAC name is [1-hydroxy-3-[methyl-[3-[3-[(E)-[[2-(pyren-1-ylmethoxy)acetyl]hydrazinylidene]methyl]phenoxy]propyl]amino]-1-phosphonopropyl]phosphonic acid.
| Compound Name | [1-hydroxy-3-[methyl-[3-[3-[(E)-[[2-(pyren-1-ylmethoxy)acetyl]hydrazinylidene]methyl]phenoxy]propyl]amino]-1-phosphonopropyl]phosphonic acid |
|---|---|
| PubChem CID | 90089164 |
| Molecular Formula | C33H37N3O10P2 |
| Molecular Weight | 697.62 g/mol |
| Exact Mass | 697.20 |
| IUPAC Name | [1-hydroxy-3-[methyl-[3-[3-[(E)-[[2-(pyren-1-ylmethoxy)acetyl]hydrazinylidene]methyl]phenoxy]propyl]amino]-1-phosphonopropyl]phosphonic acid |
| SMILES | CN(CCCOc1cccc(/C=N/NC(=O)COCc2ccc3ccc4cccc5ccc2c3c45)c1)CCC(O)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C33H37N3O10P2/c1-36(17-15-33(38,47(39,40)41)48(42,43)44)16-4-18-46-28-8-2-5-23(19-28)20-34-35-30(37)22-45-21-27-12-11-26-10-9-24-6-3-7-25-13-14-29(27)32(26)31(24)25/h2-3,5-14,19-20,38H,4,15-18,21-22H2,1H3,(H,35,37)(H2,39,40,41)(H2,42,43,44)/b34-20+ |
| InChIKey | SKBPPOLBTRZJDT-QXUDOOCXSA-N |
| XLogP | 4.34 |
| TPSA | 198.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.62 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|