C22H39Cl4N6O11P3 — CID 66550949
[3-[3-[4-[(E)-[bis[bis(2-chloroethyl)amino]phosphorylhydrazinylidene]methyl]-2-nitrophenoxy]propyl-methylamino]-1-hydroxy-1-phosphonopropyl]phosphonic acid (PubChem CID 66550949) has the molecular formula C22H39Cl4N6O11P3 and a molecular weight of 798.32 g/mol. Its IUPAC name is [3-[3-[4-[(E)-[bis[bis(2-chloroethyl)amino]phosphorylhydrazinylidene]methyl]-2-nitrophenoxy]propyl-methylamino]-1-hydroxy-1-phosphonopropyl]phosphonic acid.
| Compound Name | [3-[3-[4-[(E)-[bis[bis(2-chloroethyl)amino]phosphorylhydrazinylidene]methyl]-2-nitrophenoxy]propyl-methylamino]-1-hydroxy-1-phosphonopropyl]phosphonic acid |
|---|---|
| PubChem CID | 66550949 |
| Molecular Formula | C22H39Cl4N6O11P3 |
| Molecular Weight | 798.32 g/mol |
| Exact Mass | 796.06 |
| IUPAC Name | [3-[3-[4-[(E)-[bis[bis(2-chloroethyl)amino]phosphorylhydrazinylidene]methyl]-2-nitrophenoxy]propyl-methylamino]-1-hydroxy-1-phosphonopropyl]phosphonic acid |
| SMILES | CN(CCCOc1ccc(/C=N/NP(=O)(N(CCCl)CCCl)N(CCCl)CCCl)cc1[N+](=O)[O-])CCC(O)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C22H39Cl4N6O11P3/c1-29(11-5-22(33,44(36,37)38)45(39,40)41)10-2-16-43-21-4-3-19(17-20(21)32(34)35)18-27-28-46(42,30(12-6-23)13-7-24)31(14-8-25)15-9-26/h3-4,17-18,33H,2,5-16H2,1H3,(H,28,42)(H2,36,37,38)(H2,39,40,41)/b27-18+ |
| InChIKey | ICZSBGFGIIZPFC-OVVQPSECSA-N |
| XLogP | 3.28 |
| TPSA | 238.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.32 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|