C22H19ClFN3O5S — CID 90088546
methyl 4-[[2-(aminomethyl)-5-[(2-chloro-6-fluorobenzoyl)amino]phenyl]sulfamoyl]benzoate (PubChem CID 90088546) has the molecular formula C22H19ClFN3O5S and a molecular weight of 491.93 g/mol. Its IUPAC name is methyl 4-[[2-(aminomethyl)-5-[(2-chloro-6-fluorobenzoyl)amino]phenyl]sulfamoyl]benzoate.
| Compound Name | methyl 4-[[2-(aminomethyl)-5-[(2-chloro-6-fluorobenzoyl)amino]phenyl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 90088546 |
| Molecular Formula | C22H19ClFN3O5S |
| Molecular Weight | 491.93 g/mol |
| Exact Mass | 491.07 |
| IUPAC Name | methyl 4-[[2-(aminomethyl)-5-[(2-chloro-6-fluorobenzoyl)amino]phenyl]sulfamoyl]benzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)Nc2cc(NC(=O)c3c(F)cccc3Cl)ccc2CN)cc1 |
| InChI | InChI=1S/C22H19ClFN3O5S/c1-32-22(29)13-6-9-16(10-7-13)33(30,31)27-19-11-15(8-5-14(19)12-25)26-21(28)20-17(23)3-2-4-18(20)24/h2-11,27H,12,25H2,1H3,(H,26,28) |
| InChIKey | MWEJLQNNHOVXSX-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.93 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |