C14H14N2O4S2 — CID 90088946
3-[4-(5-amino-4-cyanothiophen-3-yl)phenoxy]propane-1-sulfonic acid (PubChem CID 90088946) has the molecular formula C14H14N2O4S2 and a molecular weight of 338.41 g/mol. Its IUPAC name is 3-[4-(5-amino-4-cyanothiophen-3-yl)phenoxy]propane-1-sulfonic acid.
| Compound Name | 3-[4-(5-amino-4-cyanothiophen-3-yl)phenoxy]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 90088946 |
| Molecular Formula | C14H14N2O4S2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | 3-[4-(5-amino-4-cyanothiophen-3-yl)phenoxy]propane-1-sulfonic acid |
| SMILES | N#Cc1c(-c2ccc(OCCCS(=O)(=O)O)cc2)csc1N |
| InChI | InChI=1S/C14H14N2O4S2/c15-8-12-13(9-21-14(12)16)10-2-4-11(5-3-10)20-6-1-7-22(17,18)19/h2-5,9H,1,6-7,16H2,(H,17,18,19) |
| InChIKey | ATNZDMBZPCLXFU-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 113.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|