About carboxyperoxy hydrogen carbonate;uranium
carboxyperoxy hydrogen carbonate;uranium (PubChem CID 90091510) has the molecular formula C2H2O7U
and a molecular weight of 376.06 g/mol. Its IUPAC name is carboxyperoxy hydrogen carbonate;uranium.
Molecular Properties
| Compound Name | carboxyperoxy hydrogen carbonate;uranium |
| PubChem CID | 90091510 |
| Molecular Formula | C2H2O7U |
| Molecular Weight | 376.06 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | carboxyperoxy hydrogen carbonate;uranium |
| SMILES | O=C(O)OOOC(=O)O.[U] |
| InChI | InChI=1S/C2H2O7.U/c3-1(4)7-9-8-2(5)6;/h(H,3,4)(H,5,6); |
| InChIKey | YTDQVVCUYDJYEY-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.06 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze carboxyperoxy hydrogen carbonate;uranium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carboxyperoxy hydrogen carbonate;uranium?
The IUPAC name of carboxyperoxy hydrogen carbonate;uranium (CID 90091510) is carboxyperoxy hydrogen carbonate;uranium.
What is the SMILES notation for carboxyperoxy hydrogen carbonate;uranium?
The canonical SMILES for carboxyperoxy hydrogen carbonate;uranium is O=C(O)OOOC(=O)O.[U].
What is the InChIKey of carboxyperoxy hydrogen carbonate;uranium?
The InChIKey is YTDQVVCUYDJYEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H2O7.U/c3-1(4)7-9-8-2(5)6;/h(H,3,4)(H,5,6);.
What are the key properties of carboxyperoxy hydrogen carbonate;uranium?
carboxyperoxy hydrogen carbonate;uranium has a molecular weight of 376.06 g/mol, XLogP of 0.22, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for carboxyperoxy hydrogen carbonate;uranium is sourced from PubChem (CID 90091510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).