aminooxy hydrogen carbonate

CH3NO4 — CID 141080921

IUPACaminooxy hydrogen carbonate
SMILESNOOC(=O)O
InChIInChI=1S/CH3NO4/c2-6-5-1(3)4/h2H2,(H,3,4)
InChIKeyPTRXNDWBGSLGEO-UHFFFAOYSA-N
MW93.04 g/mol
LogP-0.51
Rot. Bonds1

About aminooxy hydrogen carbonate

aminooxy hydrogen carbonate (PubChem CID 141080921) has the molecular formula CH3NO4 and a molecular weight of 93.04 g/mol. Its IUPAC name is aminooxy hydrogen carbonate.

Molecular Properties

Compound Nameaminooxy hydrogen carbonate
PubChem CID141080921
Molecular FormulaCH3NO4
Molecular Weight93.04 g/mol
Exact Mass93.01
IUPAC Nameaminooxy hydrogen carbonate
SMILESNOOC(=O)O
InChIInChI=1S/CH3NO4/c2-6-5-1(3)4/h2H2,(H,3,4)
InChIKeyPTRXNDWBGSLGEO-UHFFFAOYSA-N
XLogP-0.51
TPSA81.78 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms6
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 50093.04
LogP ≤ 5-0.51
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}

Analyze aminooxy hydrogen carbonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of aminooxy hydrogen carbonate?
The IUPAC name of aminooxy hydrogen carbonate (CID 141080921) is aminooxy hydrogen carbonate.
What is the SMILES notation for aminooxy hydrogen carbonate?
The canonical SMILES for aminooxy hydrogen carbonate is NOOC(=O)O.
What is the InChIKey of aminooxy hydrogen carbonate?
The InChIKey is PTRXNDWBGSLGEO-UHFFFAOYSA-N. The full InChI is InChI=1S/CH3NO4/c2-6-5-1(3)4/h2H2,(H,3,4).
What are the key properties of aminooxy hydrogen carbonate?
aminooxy hydrogen carbonate has a molecular weight of 93.04 g/mol, XLogP of -0.51, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for aminooxy hydrogen carbonate is sourced from PubChem (CID 141080921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).