amino carbamoperoxoate

CH4N2O3 — CID 154219003

IUPACamino carbamoperoxoate
SMILESNOOC(N)=O
InChIInChI=1S/CH4N2O3/c2-1(4)5-6-3/h3H2,(H2,2,4)
InChIKeyAKRNEWPPYGJHKV-UHFFFAOYSA-N
MW92.05 g/mol
LogP-1.11
Rot. Bonds1

About amino carbamoperoxoate

amino carbamoperoxoate (PubChem CID 154219003) has the molecular formula CH4N2O3 and a molecular weight of 92.05 g/mol. Its IUPAC name is amino carbamoperoxoate.

Molecular Properties

Compound Nameamino carbamoperoxoate
PubChem CID154219003
Molecular FormulaCH4N2O3
Molecular Weight92.05 g/mol
Exact Mass92.02
IUPAC Nameamino carbamoperoxoate
SMILESNOOC(N)=O
InChIInChI=1S/CH4N2O3/c2-1(4)5-6-3/h3H2,(H2,2,4)
InChIKeyAKRNEWPPYGJHKV-UHFFFAOYSA-N
XLogP-1.11
TPSA87.57 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms6
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 50092.05
LogP ≤ 5-1.11
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}

Analyze amino carbamoperoxoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of amino carbamoperoxoate?
The IUPAC name of amino carbamoperoxoate (CID 154219003) is amino carbamoperoxoate.
What is the SMILES notation for amino carbamoperoxoate?
The canonical SMILES for amino carbamoperoxoate is NOOC(N)=O.
What is the InChIKey of amino carbamoperoxoate?
The InChIKey is AKRNEWPPYGJHKV-UHFFFAOYSA-N. The full InChI is InChI=1S/CH4N2O3/c2-1(4)5-6-3/h3H2,(H2,2,4).
What are the key properties of amino carbamoperoxoate?
amino carbamoperoxoate has a molecular weight of 92.05 g/mol, XLogP of -1.11, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for amino carbamoperoxoate is sourced from PubChem (CID 154219003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).