About sulfanyl carbamoperoxoate
sulfanyl carbamoperoxoate (PubChem CID 138459846) has the molecular formula CH3NO3S
and a molecular weight of 109.11 g/mol. Its IUPAC name is sulfanyl carbamoperoxoate.
Molecular Properties
| Compound Name | sulfanyl carbamoperoxoate |
| PubChem CID | 138459846 |
| Molecular Formula | CH3NO3S |
| Molecular Weight | 109.11 g/mol |
| Exact Mass | 108.98 |
| IUPAC Name | sulfanyl carbamoperoxoate |
| SMILES | NC(=O)OOS |
| InChI | InChI=1S/CH3NO3S/c2-1(3)4-5-6/h6H,(H2,2,3) |
| InChIKey | NRWZKHSZHVVQAZ-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 109.11 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze sulfanyl carbamoperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfanyl carbamoperoxoate?
The IUPAC name of sulfanyl carbamoperoxoate (CID 138459846) is sulfanyl carbamoperoxoate.
What is the SMILES notation for sulfanyl carbamoperoxoate?
The canonical SMILES for sulfanyl carbamoperoxoate is NC(=O)OOS.
What is the InChIKey of sulfanyl carbamoperoxoate?
The InChIKey is NRWZKHSZHVVQAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/CH3NO3S/c2-1(3)4-5-6/h6H,(H2,2,3).
What are the key properties of sulfanyl carbamoperoxoate?
sulfanyl carbamoperoxoate has a molecular weight of 109.11 g/mol, XLogP of -0.14, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sulfanyl carbamoperoxoate is sourced from PubChem (CID 138459846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).