C8H12N6O13 — CID 163462835
[dicarbamoyloxy(tricarbamoyloxymethoxy)methyl] carbamate (PubChem CID 163462835) has the molecular formula C8H12N6O13 and a molecular weight of 400.21 g/mol. Its IUPAC name is [dicarbamoyloxy(tricarbamoyloxymethoxy)methyl] carbamate.
| Compound Name | [dicarbamoyloxy(tricarbamoyloxymethoxy)methyl] carbamate |
|---|---|
| PubChem CID | 163462835 |
| Molecular Formula | C8H12N6O13 |
| Molecular Weight | 400.21 g/mol |
| Exact Mass | 400.05 |
| IUPAC Name | [dicarbamoyloxy(tricarbamoyloxymethoxy)methyl] carbamate |
| SMILES | NC(=O)OC(OC(N)=O)(OC(N)=O)OC(OC(N)=O)(OC(N)=O)OC(N)=O |
| InChI | InChI=1S/C8H12N6O13/c9-1(15)21-7(22-2(10)16,23-3(11)17)27-8(24-4(12)18,25-5(13)19)26-6(14)20/h(H2,9,15)(H2,10,16)(H2,11,17)(H2,12,18)(H2,13,19)(H2,14,20) |
| InChIKey | BQBKOEUTZDDRFT-UHFFFAOYSA-N |
| XLogP | -3.20 |
| TPSA | 323.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.21 |
| LogP ≤ 5 | -3.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|