silyloxy hydrogen carbonate

CH4O4Si — CID 173188657

IUPACsilyloxy hydrogen carbonate
SMILESO=C(O)OO[SiH3]
InChIInChI=1S/CH4O4Si/c2-1(3)4-5-6/h6H3,(H,2,3)
InChIKeyHVOZQJDTTFGZJE-UHFFFAOYSA-N
MW108.12 g/mol
LogP-1.11
Rot. Bonds1

About silyloxy hydrogen carbonate

silyloxy hydrogen carbonate (PubChem CID 173188657) has the molecular formula CH4O4Si and a molecular weight of 108.12 g/mol. Its IUPAC name is silyloxy hydrogen carbonate.

Molecular Properties

Compound Namesilyloxy hydrogen carbonate
PubChem CID173188657
Molecular FormulaCH4O4Si
Molecular Weight108.12 g/mol
Exact Mass107.99
IUPAC Namesilyloxy hydrogen carbonate
SMILESO=C(O)OO[SiH3]
InChIInChI=1S/CH4O4Si/c2-1(3)4-5-6/h6H3,(H,2,3)
InChIKeyHVOZQJDTTFGZJE-UHFFFAOYSA-N
XLogP-1.11
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms6
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500108.12
LogP ≤ 5-1.11
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}

Analyze silyloxy hydrogen carbonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of silyloxy hydrogen carbonate?
The IUPAC name of silyloxy hydrogen carbonate (CID 173188657) is silyloxy hydrogen carbonate.
What is the SMILES notation for silyloxy hydrogen carbonate?
The canonical SMILES for silyloxy hydrogen carbonate is O=C(O)OO[SiH3].
What is the InChIKey of silyloxy hydrogen carbonate?
The InChIKey is HVOZQJDTTFGZJE-UHFFFAOYSA-N. The full InChI is InChI=1S/CH4O4Si/c2-1(3)4-5-6/h6H3,(H,2,3).
What are the key properties of silyloxy hydrogen carbonate?
silyloxy hydrogen carbonate has a molecular weight of 108.12 g/mol, XLogP of -1.11, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for silyloxy hydrogen carbonate is sourced from PubChem (CID 173188657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).