C20H24N2O4 — CID 90093480
(3-carbamoyl-2-pyridinyl)methyl [2,6-di(propan-2-yl)phenyl] carbonate (PubChem CID 90093480) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is (3-carbamoyl-2-pyridinyl)methyl [2,6-di(propan-2-yl)phenyl] carbonate.
| Compound Name | (3-carbamoyl-2-pyridinyl)methyl [2,6-di(propan-2-yl)phenyl] carbonate |
|---|---|
| PubChem CID | 90093480 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | (3-carbamoyl-2-pyridinyl)methyl [2,6-di(propan-2-yl)phenyl] carbonate |
| SMILES | CC(C)c1cccc(C(C)C)c1OC(=O)OCc1ncccc1C(N)=O |
| InChI | InChI=1S/C20H24N2O4/c1-12(2)14-7-5-8-15(13(3)4)18(14)26-20(24)25-11-17-16(19(21)23)9-6-10-22-17/h5-10,12-13H,11H2,1-4H3,(H2,21,23) |
| InChIKey | OJRRBNAXUOIWAU-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 91.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|