C24H23N3O2 — CID 144516381
ethane;2-[(7-phenylquinolin-5-yl)oxymethyl]pyridine-3-carboxamide (PubChem CID 144516381) has the molecular formula C24H23N3O2 and a molecular weight of 385.47 g/mol. Its IUPAC name is ethane;2-[(7-phenylquinolin-5-yl)oxymethyl]pyridine-3-carboxamide.
| Compound Name | ethane;2-[(7-phenylquinolin-5-yl)oxymethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 144516381 |
| Molecular Formula | C24H23N3O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | ethane;2-[(7-phenylquinolin-5-yl)oxymethyl]pyridine-3-carboxamide |
| SMILES | CC.NC(=O)c1cccnc1COc1cc(-c2ccccc2)cc2ncccc12 |
| InChI | InChI=1S/C22H17N3O2.C2H6/c23-22(26)18-9-5-11-25-20(18)14-27-21-13-16(15-6-2-1-3-7-15)12-19-17(21)8-4-10-24-19;1-2/h1-13H,14H2,(H2,23,26);1-2H3 |
| InChIKey | ZNUSOHNSRPJFMX-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |