C23H18N2O4S — CID 71244060
4-[5-[(2-carbamoylphenyl)methoxy]quinolin-7-yl]benzenesulfinic acid (PubChem CID 71244060) has the molecular formula C23H18N2O4S and a molecular weight of 418.47 g/mol. Its IUPAC name is 4-[5-[(2-carbamoylphenyl)methoxy]quinolin-7-yl]benzenesulfinic acid.
| Compound Name | 4-[5-[(2-carbamoylphenyl)methoxy]quinolin-7-yl]benzenesulfinic acid |
|---|---|
| PubChem CID | 71244060 |
| Molecular Formula | C23H18N2O4S |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | 4-[5-[(2-carbamoylphenyl)methoxy]quinolin-7-yl]benzenesulfinic acid |
| SMILES | NC(=O)c1ccccc1COc1cc(-c2ccc(S(=O)O)cc2)cc2ncccc12 |
| InChI | InChI=1S/C23H18N2O4S/c24-23(26)19-5-2-1-4-16(19)14-29-22-13-17(12-21-20(22)6-3-11-25-21)15-7-9-18(10-8-15)30(27)28/h1-13H,14H2,(H2,24,26)(H,27,28) |
| InChIKey | ALRNZCKKPGCWCX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 102.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|