C24H21N5O2 — CID 144516316
2-[[7-[3-(aminomethyl)-4-methanimidoylphenyl]quinolin-5-yl]oxymethyl]pyridine-3-carboxamide (PubChem CID 144516316) has the molecular formula C24H21N5O2 and a molecular weight of 411.47 g/mol. Its IUPAC name is 2-[[7-[3-(aminomethyl)-4-methanimidoylphenyl]quinolin-5-yl]oxymethyl]pyridine-3-carboxamide.
| Compound Name | 2-[[7-[3-(aminomethyl)-4-methanimidoylphenyl]quinolin-5-yl]oxymethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 144516316 |
| Molecular Formula | C24H21N5O2 |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 2-[[7-[3-(aminomethyl)-4-methanimidoylphenyl]quinolin-5-yl]oxymethyl]pyridine-3-carboxamide |
| SMILES | [H]/N=C/c1ccc(-c2cc(OCc3ncccc3C(N)=O)c3cccnc3c2)cc1CN |
| InChI | InChI=1S/C24H21N5O2/c25-12-16-6-5-15(9-18(16)13-26)17-10-21-19(3-1-7-28-21)23(11-17)31-14-22-20(24(27)30)4-2-8-29-22/h1-12,25H,13-14,26H2,(H2,27,30)/b25-12+ |
| InChIKey | POJMOJICQIWHRM-BRJLIKDPSA-N |
| XLogP | 3.43 |
| TPSA | 127.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|