C23H17N2O4S- — CID 71244059
4-[5-[(2-carbamoylphenyl)methoxy]quinolin-7-yl]benzenesulfinate (PubChem CID 71244059) has the molecular formula C23H17N2O4S- and a molecular weight of 417.47 g/mol. Its IUPAC name is 4-[5-[(2-carbamoylphenyl)methoxy]quinolin-7-yl]benzenesulfinate.
| Compound Name | 4-[5-[(2-carbamoylphenyl)methoxy]quinolin-7-yl]benzenesulfinate |
|---|---|
| PubChem CID | 71244059 |
| Molecular Formula | C23H17N2O4S- |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | 4-[5-[(2-carbamoylphenyl)methoxy]quinolin-7-yl]benzenesulfinate |
| SMILES | NC(=O)c1ccccc1COc1cc(-c2ccc(S(=O)[O-])cc2)cc2ncccc12 |
| InChI | InChI=1S/C23H18N2O4S/c24-23(26)19-5-2-1-4-16(19)14-29-22-13-17(12-21-20(22)6-3-11-25-21)15-7-9-18(10-8-15)30(27)28/h1-13H,14H2,(H2,24,26)(H,27,28)/p-1 |
| InChIKey | ALRNZCKKPGCWCX-UHFFFAOYSA-M |
| XLogP | 3.82 |
| TPSA | 105.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|