C8H13NO8 — CID 90094500
tris(carboxymethyl)azanium acetate (PubChem CID 90094500) has the molecular formula C8H13NO8 and a molecular weight of 251.19 g/mol. Its IUPAC name is tris(carboxymethyl)azanium acetate.
| Compound Name | tris(carboxymethyl)azanium acetate |
|---|---|
| PubChem CID | 90094500 |
| Molecular Formula | C8H13NO8 |
| Molecular Weight | 251.19 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | tris(carboxymethyl)azanium acetate |
| SMILES | CC(=O)[O-].O=C(O)C[NH+](CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C6H9NO6.C2H4O2/c8-4(9)1-7(2-5(10)11)3-6(12)13;1-2(3)4/h1-3H2,(H,8,9)(H,10,11)(H,12,13);1H3,(H,3,4) |
| InChIKey | UKBRRNABCPHPTB-UHFFFAOYSA-N |
| XLogP | -4.12 |
| TPSA | 156.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.19 |
| LogP ≤ 5 | -4.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |