About [2-(pentylamino)phenyl] propanoate
[2-(pentylamino)phenyl] propanoate (PubChem CID 90097401) has the molecular formula C14H21NO2
and a molecular weight of 235.33 g/mol. Its IUPAC name is [2-(pentylamino)phenyl] propanoate.
Molecular Properties
| Compound Name | [2-(pentylamino)phenyl] propanoate |
| PubChem CID | 90097401 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | [2-(pentylamino)phenyl] propanoate |
| SMILES | CCCCCNc1ccccc1OC(=O)CC |
| InChI | InChI=1S/C14H21NO2/c1-3-5-8-11-15-12-9-6-7-10-13(12)17-14(16)4-2/h6-7,9-10,15H,3-5,8,11H2,1-2H3 |
| InChIKey | RLCIMQJSSVYFCG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-(pentylamino)phenyl] propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(pentylamino)phenyl] propanoate?
The IUPAC name of [2-(pentylamino)phenyl] propanoate (CID 90097401) is [2-(pentylamino)phenyl] propanoate.
What is the SMILES notation for [2-(pentylamino)phenyl] propanoate?
The canonical SMILES for [2-(pentylamino)phenyl] propanoate is CCCCCNc1ccccc1OC(=O)CC.
What is the InChIKey of [2-(pentylamino)phenyl] propanoate?
The InChIKey is RLCIMQJSSVYFCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO2/c1-3-5-8-11-15-12-9-6-7-10-13(12)17-14(16)4-2/h6-7,9-10,15H,3-5,8,11H2,1-2H3.
What are the key properties of [2-(pentylamino)phenyl] propanoate?
[2-(pentylamino)phenyl] propanoate has a molecular weight of 235.33 g/mol, XLogP of 3.60, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(pentylamino)phenyl] propanoate is sourced from PubChem (CID 90097401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).