About [(E)-1-chloro-2-ethoxyethenyl]-tetrafluoro-(4-nitrophenyl)-λ6-sulfane
[(E)-1-chloro-2-ethoxyethenyl]-tetrafluoro-(4-nitrophenyl)-λ6-sulfane (PubChem CID 90100348) has the molecular formula C10H10ClF4NO3S
and a molecular weight of 335.71 g/mol. Its IUPAC name is [(E)-1-chloro-2-ethoxyethenyl]-tetrafluoro-(4-nitrophenyl)-λ6-sulfane.
Molecular Properties
| Compound Name | [(E)-1-chloro-2-ethoxyethenyl]-tetrafluoro-(4-nitrophenyl)-λ6-sulfane |
| PubChem CID | 90100348 |
| Molecular Formula | C10H10ClF4NO3S |
| Molecular Weight | 335.71 g/mol |
| Exact Mass | 335.00 |
| IUPAC Name | [(E)-1-chloro-2-ethoxyethenyl]-tetrafluoro-(4-nitrophenyl)-λ6-sulfane |
| SMILES | CCO/C=C(/Cl)S(F)(F)(F)(F)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C10H10ClF4NO3S/c1-2-19-7-10(11)20(12,13,14,15)9-5-3-8(4-6-9)16(17)18/h3-7H,2H2,1H3/b10-7- |
| InChIKey | KOVXJFNSIZOJIO-YFHOEESVSA-N |
| XLogP | 5.44 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.71 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-1-chloro-2-ethoxyethenyl]-tetrafluoro-(4-nitrophenyl)-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-1-chloro-2-ethoxyethenyl]-tetrafluoro-(4-nitrophenyl)-λ6-sulfane?
The IUPAC name of [(E)-1-chloro-2-ethoxyethenyl]-tetrafluoro-(4-nitrophenyl)-λ6-sulfane (CID 90100348) is [(E)-1-chloro-2-ethoxyethenyl]-tetrafluoro-(4-nitrophenyl)-λ6-sulfane.
What is the SMILES notation for [(E)-1-chloro-2-ethoxyethenyl]-tetrafluoro-(4-nitrophenyl)-λ6-sulfane?
The canonical SMILES for [(E)-1-chloro-2-ethoxyethenyl]-tetrafluoro-(4-nitrophenyl)-λ6-sulfane is CCO/C=C(/Cl)S(F)(F)(F)(F)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of [(E)-1-chloro-2-ethoxyethenyl]-tetrafluoro-(4-nitrophenyl)-λ6-sulfane?
The InChIKey is KOVXJFNSIZOJIO-YFHOEESVSA-N. The full InChI is InChI=1S/C10H10ClF4NO3S/c1-2-19-7-10(11)20(12,13,14,15)9-5-3-8(4-6-9)16(17)18/h3-7H,2H2,1H3/b10-7-.
What are the key properties of [(E)-1-chloro-2-ethoxyethenyl]-tetrafluoro-(4-nitrophenyl)-λ6-sulfane?
[(E)-1-chloro-2-ethoxyethenyl]-tetrafluoro-(4-nitrophenyl)-λ6-sulfane has a molecular weight of 335.71 g/mol, XLogP of 5.44, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-1-chloro-2-ethoxyethenyl]-tetrafluoro-(4-nitrophenyl)-λ6-sulfane is sourced from PubChem (CID 90100348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).