About (3-chlorophenyl)-(2,4-dichloro-3-phenylquinolin-6-yl)-(6-methyl-3-pyridinyl)methanol
(3-chlorophenyl)-(2,4-dichloro-3-phenylquinolin-6-yl)-(6-methyl-3-pyridinyl)methanol (PubChem CID 90100481) has the molecular formula C28H19Cl3N2O
and a molecular weight of 505.83 g/mol. Its IUPAC name is (3-chlorophenyl)-(2,4-dichloro-3-phenylquinolin-6-yl)-(6-methyl-3-pyridinyl)methanol.
Molecular Properties
| Compound Name | (3-chlorophenyl)-(2,4-dichloro-3-phenylquinolin-6-yl)-(6-methyl-3-pyridinyl)methanol |
| PubChem CID | 90100481 |
| Molecular Formula | C28H19Cl3N2O |
| Molecular Weight | 505.83 g/mol |
| Exact Mass | 504.06 |
| IUPAC Name | (3-chlorophenyl)-(2,4-dichloro-3-phenylquinolin-6-yl)-(6-methyl-3-pyridinyl)methanol |
| SMILES | Cc1ccc(C(O)(c2cccc(Cl)c2)c2ccc3nc(Cl)c(-c4ccccc4)c(Cl)c3c2)cn1 |
| InChI | InChI=1S/C28H19Cl3N2O/c1-17-10-11-21(16-32-17)28(34,19-8-5-9-22(29)14-19)20-12-13-24-23(15-20)26(30)25(27(31)33-24)18-6-3-2-4-7-18/h2-16,34H,1H3 |
| InChIKey | GTBLSEUVUKKEHK-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 505.83 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (3-chlorophenyl)-(2,4-dichloro-3-phenylquinolin-6-yl)-(6-methyl-3-pyridinyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-chlorophenyl)-(2,4-dichloro-3-phenylquinolin-6-yl)-(6-methyl-3-pyridinyl)methanol?
The IUPAC name of (3-chlorophenyl)-(2,4-dichloro-3-phenylquinolin-6-yl)-(6-methyl-3-pyridinyl)methanol (CID 90100481) is (3-chlorophenyl)-(2,4-dichloro-3-phenylquinolin-6-yl)-(6-methyl-3-pyridinyl)methanol.
What is the SMILES notation for (3-chlorophenyl)-(2,4-dichloro-3-phenylquinolin-6-yl)-(6-methyl-3-pyridinyl)methanol?
The canonical SMILES for (3-chlorophenyl)-(2,4-dichloro-3-phenylquinolin-6-yl)-(6-methyl-3-pyridinyl)methanol is Cc1ccc(C(O)(c2cccc(Cl)c2)c2ccc3nc(Cl)c(-c4ccccc4)c(Cl)c3c2)cn1.
What is the InChIKey of (3-chlorophenyl)-(2,4-dichloro-3-phenylquinolin-6-yl)-(6-methyl-3-pyridinyl)methanol?
The InChIKey is GTBLSEUVUKKEHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H19Cl3N2O/c1-17-10-11-21(16-32-17)28(34,19-8-5-9-22(29)14-19)20-12-13-24-23(15-20)26(30)25(27(31)33-24)18-6-3-2-4-7-18/h2-16,34H,1H3.
What are the key properties of (3-chlorophenyl)-(2,4-dichloro-3-phenylquinolin-6-yl)-(6-methyl-3-pyridinyl)methanol?
(3-chlorophenyl)-(2,4-dichloro-3-phenylquinolin-6-yl)-(6-methyl-3-pyridinyl)methanol has a molecular weight of 505.83 g/mol, XLogP of 7.85, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-chlorophenyl)-(2,4-dichloro-3-phenylquinolin-6-yl)-(6-methyl-3-pyridinyl)methanol is sourced from PubChem (CID 90100481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).