C28H16Cl3F3N2O — CID 90101573
(3-chlorophenyl)-(2,4-dichloro-3-phenylquinolin-6-yl)-[6-(trifluoromethyl)-3-pyridinyl]methanol (PubChem CID 90101573) has the molecular formula C28H16Cl3F3N2O and a molecular weight of 559.80 g/mol. Its IUPAC name is (3-chlorophenyl)-(2,4-dichloro-3-phenylquinolin-6-yl)-[6-(trifluoromethyl)-3-pyridinyl]methanol.
| Compound Name | (3-chlorophenyl)-(2,4-dichloro-3-phenylquinolin-6-yl)-[6-(trifluoromethyl)-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 90101573 |
| Molecular Formula | C28H16Cl3F3N2O |
| Molecular Weight | 559.80 g/mol |
| Exact Mass | 558.03 |
| IUPAC Name | (3-chlorophenyl)-(2,4-dichloro-3-phenylquinolin-6-yl)-[6-(trifluoromethyl)-3-pyridinyl]methanol |
| SMILES | OC(c1ccc(C(F)(F)F)nc1)(c1cccc(Cl)c1)c1ccc2nc(Cl)c(-c3ccccc3)c(Cl)c2c1 |
| InChI | InChI=1S/C28H16Cl3F3N2O/c29-20-8-4-7-17(13-20)27(37,19-10-12-23(35-15-19)28(32,33)34)18-9-11-22-21(14-18)25(30)24(26(31)36-22)16-5-2-1-3-6-16/h1-15,37H |
| InChIKey | PJSOWUHYHVFXQK-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.80 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|