C19H20ClF2N3O — CID 90101600
2-[4-[5-(chloromethyl)-2-methylpyrimidin-4-yl]piperidin-1-yl]-2-(2,6-difluorophenyl)acetaldehyde (PubChem CID 90101600) has the molecular formula C19H20ClF2N3O and a molecular weight of 379.84 g/mol. Its IUPAC name is 2-[4-[5-(chloromethyl)-2-methylpyrimidin-4-yl]piperidin-1-yl]-2-(2,6-difluorophenyl)acetaldehyde.
| Compound Name | 2-[4-[5-(chloromethyl)-2-methylpyrimidin-4-yl]piperidin-1-yl]-2-(2,6-difluorophenyl)acetaldehyde |
|---|---|
| PubChem CID | 90101600 |
| Molecular Formula | C19H20ClF2N3O |
| Molecular Weight | 379.84 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 2-[4-[5-(chloromethyl)-2-methylpyrimidin-4-yl]piperidin-1-yl]-2-(2,6-difluorophenyl)acetaldehyde |
| SMILES | Cc1ncc(CCl)c(C2CCN(C(C=O)c3c(F)cccc3F)CC2)n1 |
| InChI | InChI=1S/C19H20ClF2N3O/c1-12-23-10-14(9-20)19(24-12)13-5-7-25(8-6-13)17(11-26)18-15(21)3-2-4-16(18)22/h2-4,10-11,13,17H,5-9H2,1H3 |
| InChIKey | GGSHYJXCQLLGOH-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.84 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|