About spiro[1H-pyrrolo[2,3-c]pyridine-3,1'-cyclopentane]-2-one
spiro[1H-pyrrolo[2,3-c]pyridine-3,1'-cyclopentane]-2-one (PubChem CID 90103164) has the molecular formula C11H12N2O
and a molecular weight of 188.23 g/mol. Its IUPAC name is spiro[1H-pyrrolo[2,3-c]pyridine-3,1'-cyclopentane]-2-one.
Molecular Properties
| Compound Name | spiro[1H-pyrrolo[2,3-c]pyridine-3,1'-cyclopentane]-2-one |
| PubChem CID | 90103164 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | spiro[1H-pyrrolo[2,3-c]pyridine-3,1'-cyclopentane]-2-one |
| SMILES | O=C1Nc2cnccc2C12CCCC2 |
| InChI | InChI=1S/C11H12N2O/c14-10-11(4-1-2-5-11)8-3-6-12-7-9(8)13-10/h3,6-7H,1-2,4-5H2,(H,13,14) |
| InChIKey | GOTDBVXVYHQCOX-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze spiro[1H-pyrrolo[2,3-c]pyridine-3,1'-cyclopentane]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1H-pyrrolo[2,3-c]pyridine-3,1'-cyclopentane]-2-one?
The IUPAC name of spiro[1H-pyrrolo[2,3-c]pyridine-3,1'-cyclopentane]-2-one (CID 90103164) is spiro[1H-pyrrolo[2,3-c]pyridine-3,1'-cyclopentane]-2-one.
What is the SMILES notation for spiro[1H-pyrrolo[2,3-c]pyridine-3,1'-cyclopentane]-2-one?
The canonical SMILES for spiro[1H-pyrrolo[2,3-c]pyridine-3,1'-cyclopentane]-2-one is O=C1Nc2cnccc2C12CCCC2.
What is the InChIKey of spiro[1H-pyrrolo[2,3-c]pyridine-3,1'-cyclopentane]-2-one?
The InChIKey is GOTDBVXVYHQCOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O/c14-10-11(4-1-2-5-11)8-3-6-12-7-9(8)13-10/h3,6-7H,1-2,4-5H2,(H,13,14).
What are the key properties of spiro[1H-pyrrolo[2,3-c]pyridine-3,1'-cyclopentane]-2-one?
spiro[1H-pyrrolo[2,3-c]pyridine-3,1'-cyclopentane]-2-one has a molecular weight of 188.23 g/mol, XLogP of 1.85, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1H-pyrrolo[2,3-c]pyridine-3,1'-cyclopentane]-2-one is sourced from PubChem (CID 90103164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).