C18H14F3NO3 — CID 9010573
[2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 2,3-dihydro-1H-indene-5-carboxylate (PubChem CID 9010573) has the molecular formula C18H14F3NO3 and a molecular weight of 349.31 g/mol. Its IUPAC name is [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 2,3-dihydro-1H-indene-5-carboxylate.
| Compound Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 2,3-dihydro-1H-indene-5-carboxylate |
|---|---|
| PubChem CID | 9010573 |
| Molecular Formula | C18H14F3NO3 |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 2,3-dihydro-1H-indene-5-carboxylate |
| SMILES | O=C(COC(=O)c1ccc2c(c1)CCC2)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C18H14F3NO3/c19-13-6-7-14(17(21)16(13)20)22-15(23)9-25-18(24)12-5-4-10-2-1-3-11(10)8-12/h4-8H,1-3,9H2,(H,22,23) |
| InChIKey | HRZBDVYUHDZGHF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|