C19H22Cl2N2O3 — CID 90106601
2,6-diamino-3,5-bis(3-chloro-4-hydroxyphenyl)heptan-4-one (PubChem CID 90106601) has the molecular formula C19H22Cl2N2O3 and a molecular weight of 397.30 g/mol. Its IUPAC name is 2,6-diamino-3,5-bis(3-chloro-4-hydroxyphenyl)heptan-4-one.
| Compound Name | 2,6-diamino-3,5-bis(3-chloro-4-hydroxyphenyl)heptan-4-one |
|---|---|
| PubChem CID | 90106601 |
| Molecular Formula | C19H22Cl2N2O3 |
| Molecular Weight | 397.30 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 2,6-diamino-3,5-bis(3-chloro-4-hydroxyphenyl)heptan-4-one |
| SMILES | CC(N)C(C(=O)C(c1ccc(O)c(Cl)c1)C(C)N)c1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C19H22Cl2N2O3/c1-9(22)17(11-3-5-15(24)13(20)7-11)19(26)18(10(2)23)12-4-6-16(25)14(21)8-12/h3-10,17-18,24-25H,22-23H2,1-2H3 |
| InChIKey | FSEBMLMNTSTBLS-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.30 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |