C22H21ClN4O2 — CID 90110924
ethyl 2-[6-[[2-(3-chlorophenyl)-6-cyclopropylpyrimidin-4-yl]amino]-3-pyridinyl]acetate (PubChem CID 90110924) has the molecular formula C22H21ClN4O2 and a molecular weight of 408.89 g/mol. Its IUPAC name is ethyl 2-[6-[[2-(3-chlorophenyl)-6-cyclopropylpyrimidin-4-yl]amino]-3-pyridinyl]acetate.
| Compound Name | ethyl 2-[6-[[2-(3-chlorophenyl)-6-cyclopropylpyrimidin-4-yl]amino]-3-pyridinyl]acetate |
|---|---|
| PubChem CID | 90110924 |
| Molecular Formula | C22H21ClN4O2 |
| Molecular Weight | 408.89 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | ethyl 2-[6-[[2-(3-chlorophenyl)-6-cyclopropylpyrimidin-4-yl]amino]-3-pyridinyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(Nc2cc(C3CC3)nc(-c3cccc(Cl)c3)n2)nc1 |
| InChI | InChI=1S/C22H21ClN4O2/c1-2-29-21(28)10-14-6-9-19(24-13-14)26-20-12-18(15-7-8-15)25-22(27-20)16-4-3-5-17(23)11-16/h3-6,9,11-13,15H,2,7-8,10H2,1H3,(H,24,25,26,27) |
| InChIKey | ATUUWOYQLDBSDO-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.89 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |