C27H34ClN5O3S — CID 90116448
5-chloro-2-(5-methyl-4-piperidin-4-yl-2,3-dihydro-1-benzofuran-7-yl)-4-(2-propan-2-ylsulfonylphenyl)pyrimidine;hydrazine (PubChem CID 90116448) has the molecular formula C27H34ClN5O3S and a molecular weight of 544.12 g/mol. Its IUPAC name is 5-chloro-2-(5-methyl-4-piperidin-4-yl-2,3-dihydro-1-benzofuran-7-yl)-4-(2-propan-2-ylsulfonylphenyl)pyrimidine;hydrazine.
| Compound Name | 5-chloro-2-(5-methyl-4-piperidin-4-yl-2,3-dihydro-1-benzofuran-7-yl)-4-(2-propan-2-ylsulfonylphenyl)pyrimidine;hydrazine |
|---|---|
| PubChem CID | 90116448 |
| Molecular Formula | C27H34ClN5O3S |
| Molecular Weight | 544.12 g/mol |
| Exact Mass | 543.21 |
| IUPAC Name | 5-chloro-2-(5-methyl-4-piperidin-4-yl-2,3-dihydro-1-benzofuran-7-yl)-4-(2-propan-2-ylsulfonylphenyl)pyrimidine;hydrazine |
| SMILES | Cc1cc(-c2ncc(Cl)c(-c3ccccc3S(=O)(=O)C(C)C)n2)c2c(c1C1CCNCC1)CCO2.NN |
| InChI | InChI=1S/C27H30ClN3O3S.H4N2/c1-16(2)35(32,33)23-7-5-4-6-19(23)25-22(28)15-30-27(31-25)21-14-17(3)24(18-8-11-29-12-9-18)20-10-13-34-26(20)21;1-2/h4-7,14-16,18,29H,8-13H2,1-3H3;1-2H2 |
| InChIKey | KUQBJVWJTNVWGM-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 133.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.12 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|