C11H17NO2 — CID 90119998
3-(oxolan-2-ylmethyl)hexa-2,5-dienamide (PubChem CID 90119998) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is 3-(oxolan-2-ylmethyl)hexa-2,5-dienamide.
| Compound Name | 3-(oxolan-2-ylmethyl)hexa-2,5-dienamide |
|---|---|
| PubChem CID | 90119998 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 3-(oxolan-2-ylmethyl)hexa-2,5-dienamide |
| SMILES | C=CCC(=CC(N)=O)CC1CCCO1 |
| InChI | InChI=1S/C11H17NO2/c1-2-4-9(8-11(12)13)7-10-5-3-6-14-10/h2,8,10H,1,3-7H2,(H2,12,13) |
| InChIKey | YRDBWFZTYMDCCO-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|