C44H52N6O5P+ — CID 90120408
oxo-bis[3-[[4-[5-(4-phenylbutyl)-1,2,4-oxadiazol-3-yl]phenyl]methylamino]propoxy]phosphanium (PubChem CID 90120408) has the molecular formula C44H52N6O5P+ and a molecular weight of 775.91 g/mol. Its IUPAC name is oxo-bis[3-[[4-[5-(4-phenylbutyl)-1,2,4-oxadiazol-3-yl]phenyl]methylamino]propoxy]phosphanium.
| Compound Name | oxo-bis[3-[[4-[5-(4-phenylbutyl)-1,2,4-oxadiazol-3-yl]phenyl]methylamino]propoxy]phosphanium |
|---|---|
| PubChem CID | 90120408 |
| Molecular Formula | C44H52N6O5P+ |
| Molecular Weight | 775.91 g/mol |
| Exact Mass | 775.37 |
| IUPAC Name | oxo-bis[3-[[4-[5-(4-phenylbutyl)-1,2,4-oxadiazol-3-yl]phenyl]methylamino]propoxy]phosphanium |
| SMILES | O=[P+](OCCCNCc1ccc(-c2noc(CCCCc3ccccc3)n2)cc1)OCCCNCc1ccc(-c2noc(CCCCc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C44H52N6O5P/c51-56(52-31-11-29-45-33-37-21-25-39(26-22-37)43-47-41(54-49-43)19-9-7-17-35-13-3-1-4-14-35)53-32-12-30-46-34-38-23-27-40(28-24-38)44-48-42(55-50-44)20-10-8-18-36-15-5-2-6-16-36/h1-6,13-16,21-28,45-46H,7-12,17-20,29-34H2/q+1 |
| InChIKey | OGPPKNKSXZVXNV-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 137.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.91 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|