C20H22N2O2 — CID 90091839
[4-[5-(5-phenylpentyl)-1,2,4-oxadiazol-3-yl]phenyl]methanol (PubChem CID 90091839) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is [4-[5-(5-phenylpentyl)-1,2,4-oxadiazol-3-yl]phenyl]methanol.
| Compound Name | [4-[5-(5-phenylpentyl)-1,2,4-oxadiazol-3-yl]phenyl]methanol |
|---|---|
| PubChem CID | 90091839 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | [4-[5-(5-phenylpentyl)-1,2,4-oxadiazol-3-yl]phenyl]methanol |
| SMILES | OCc1ccc(-c2noc(CCCCCc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C20H22N2O2/c23-15-17-11-13-18(14-12-17)20-21-19(24-22-20)10-6-2-5-9-16-7-3-1-4-8-16/h1,3-4,7-8,11-14,23H,2,5-6,9-10,15H2 |
| InChIKey | OPPJKFATRYDTJI-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|