C26H35N3O2 — CID 162755662
1-[4-[5-(4-methylpentyl)-1,2,4-oxadiazol-3-yl]phenyl]-N-(4-phenylbutoxy)ethanamine (PubChem CID 162755662) has the molecular formula C26H35N3O2 and a molecular weight of 421.59 g/mol. Its IUPAC name is 1-[4-[5-(4-methylpentyl)-1,2,4-oxadiazol-3-yl]phenyl]-N-(4-phenylbutoxy)ethanamine.
| Compound Name | 1-[4-[5-(4-methylpentyl)-1,2,4-oxadiazol-3-yl]phenyl]-N-(4-phenylbutoxy)ethanamine |
|---|---|
| PubChem CID | 162755662 |
| Molecular Formula | C26H35N3O2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.27 |
| IUPAC Name | 1-[4-[5-(4-methylpentyl)-1,2,4-oxadiazol-3-yl]phenyl]-N-(4-phenylbutoxy)ethanamine |
| SMILES | CC(C)CCCc1nc(-c2ccc(C(C)NOCCCCc3ccccc3)cc2)no1 |
| InChI | InChI=1S/C26H35N3O2/c1-20(2)10-9-14-25-27-26(29-31-25)24-17-15-23(16-18-24)21(3)28-30-19-8-7-13-22-11-5-4-6-12-22/h4-6,11-12,15-18,20-21,28H,7-10,13-14,19H2,1-3H3 |
| InChIKey | YBJFNRBOLWFSML-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|