C24H33N5O3 — CID 90121123
(2S,4S)-4-amino-1-[(2S)-2-[[(2S)-2-(methylamino)propanoyl]amino]pent-4-ynoyl]-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrrolidine-2-carboxamide (PubChem CID 90121123) has the molecular formula C24H33N5O3 and a molecular weight of 439.56 g/mol. Its IUPAC name is (2S,4S)-4-amino-1-[(2S)-2-[[(2S)-2-(methylamino)propanoyl]amino]pent-4-ynoyl]-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-4-amino-1-[(2S)-2-[[(2S)-2-(methylamino)propanoyl]amino]pent-4-ynoyl]-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 90121123 |
| Molecular Formula | C24H33N5O3 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | (2S,4S)-4-amino-1-[(2S)-2-[[(2S)-2-(methylamino)propanoyl]amino]pent-4-ynoyl]-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrrolidine-2-carboxamide |
| SMILES | C#CC[C@H](NC(=O)[C@H](C)NC)C(=O)N1C[C@@H](N)C[C@H]1C(=O)N[C@@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C24H33N5O3/c1-4-8-20(28-22(30)15(2)26-3)24(32)29-14-17(25)13-21(29)23(31)27-19-12-7-10-16-9-5-6-11-18(16)19/h1,5-6,9,11,15,17,19-21,26H,7-8,10,12-14,25H2,2-3H3,(H,27,31)(H,28,30)/t15-,17-,19+,20-,21-/m0/s1 |
| InChIKey | SWVWKKMEXUTGQX-VPOJOSCRSA-N |
| XLogP | 0.22 |
| TPSA | 116.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|