C12H12F2O5 — CID 90124119
4-[2-(2,3-difluorophenoxy)ethoxy]-4-oxobutanoic acid (PubChem CID 90124119) has the molecular formula C12H12F2O5 and a molecular weight of 274.22 g/mol. Its IUPAC name is 4-[2-(2,3-difluorophenoxy)ethoxy]-4-oxobutanoic acid.
| Compound Name | 4-[2-(2,3-difluorophenoxy)ethoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 90124119 |
| Molecular Formula | C12H12F2O5 |
| Molecular Weight | 274.22 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 4-[2-(2,3-difluorophenoxy)ethoxy]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)OCCOc1cccc(F)c1F |
| InChI | InChI=1S/C12H12F2O5/c13-8-2-1-3-9(12(8)14)18-6-7-19-11(17)5-4-10(15)16/h1-3H,4-7H2,(H,15,16) |
| InChIKey | PVXCQVFMHLOFMT-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.22 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|