C19H20O6 — CID 123896806
4-[2-[4-(2-methoxyphenyl)phenoxy]ethoxy]-4-oxobutanoic acid (PubChem CID 123896806) has the molecular formula C19H20O6 and a molecular weight of 344.36 g/mol. Its IUPAC name is 4-[2-[4-(2-methoxyphenyl)phenoxy]ethoxy]-4-oxobutanoic acid.
| Compound Name | 4-[2-[4-(2-methoxyphenyl)phenoxy]ethoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 123896806 |
| Molecular Formula | C19H20O6 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 4-[2-[4-(2-methoxyphenyl)phenoxy]ethoxy]-4-oxobutanoic acid |
| SMILES | COc1ccccc1-c1ccc(OCCOC(=O)CCC(=O)O)cc1 |
| InChI | InChI=1S/C19H20O6/c1-23-17-5-3-2-4-16(17)14-6-8-15(9-7-14)24-12-13-25-19(22)11-10-18(20)21/h2-9H,10-13H2,1H3,(H,20,21) |
| InChIKey | BOONQPOOPHAGMG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|