C16H22N2O3 — CID 9012496
2-[4-[(Z)-[(2S,6R)-2,6-dimethylpiperidin-1-yl]iminomethyl]phenoxy]acetic acid (PubChem CID 9012496) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is 2-[4-[(Z)-[(2S,6R)-2,6-dimethylpiperidin-1-yl]iminomethyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[(Z)-[(2S,6R)-2,6-dimethylpiperidin-1-yl]iminomethyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 9012496 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 2-[4-[(Z)-[(2S,6R)-2,6-dimethylpiperidin-1-yl]iminomethyl]phenoxy]acetic acid |
| SMILES | C[C@@H]1CCC[C@H](C)N1/N=C\c1ccc(OCC(=O)O)cc1 |
| InChI | InChI=1S/C16H22N2O3/c1-12-4-3-5-13(2)18(12)17-10-14-6-8-15(9-7-14)21-11-16(19)20/h6-10,12-13H,3-5,11H2,1-2H3,(H,19,20)/b17-10-/t12-,13+ |
| InChIKey | AOOMOSZRVFKKPJ-CTZPAZJCSA-N |
| XLogP | 2.75 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|