C15H16O5S — CID 90126077
4-[(3-acetyl-5-methylfuran-2-yl)methylsulfanylmethyl]-5-methylfuran-2-carboxylic acid (PubChem CID 90126077) has the molecular formula C15H16O5S and a molecular weight of 308.36 g/mol. Its IUPAC name is 4-[(3-acetyl-5-methylfuran-2-yl)methylsulfanylmethyl]-5-methylfuran-2-carboxylic acid.
| Compound Name | 4-[(3-acetyl-5-methylfuran-2-yl)methylsulfanylmethyl]-5-methylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 90126077 |
| Molecular Formula | C15H16O5S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 4-[(3-acetyl-5-methylfuran-2-yl)methylsulfanylmethyl]-5-methylfuran-2-carboxylic acid |
| SMILES | CC(=O)c1cc(C)oc1CSCc1cc(C(=O)O)oc1C |
| InChI | InChI=1S/C15H16O5S/c1-8-4-12(9(2)16)14(19-8)7-21-6-11-5-13(15(17)18)20-10(11)3/h4-5H,6-7H2,1-3H3,(H,17,18) |
| InChIKey | LLQHFTNOOOQHOD-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |