C18H30O6S — CID 90129308
4-[2-[2-(2-ethylhexoxy)ethoxy]ethoxy]benzenesulfonic acid (PubChem CID 90129308) has the molecular formula C18H30O6S and a molecular weight of 374.50 g/mol. Its IUPAC name is 4-[2-[2-(2-ethylhexoxy)ethoxy]ethoxy]benzenesulfonic acid.
| Compound Name | 4-[2-[2-(2-ethylhexoxy)ethoxy]ethoxy]benzenesulfonic acid |
|---|---|
| PubChem CID | 90129308 |
| Molecular Formula | C18H30O6S |
| Molecular Weight | 374.50 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 4-[2-[2-(2-ethylhexoxy)ethoxy]ethoxy]benzenesulfonic acid |
| SMILES | CCCCC(CC)COCCOCCOc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C18H30O6S/c1-3-5-6-16(4-2)15-23-12-11-22-13-14-24-17-7-9-18(10-8-17)25(19,20)21/h7-10,16H,3-6,11-15H2,1-2H3,(H,19,20,21) |
| InChIKey | MYWUAPWUWZFKFL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.50 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|