C18H31NO4S — CID 3432090
N-[3-(2-ethylhexoxy)propyl]-4-methoxybenzenesulfonamide (PubChem CID 3432090) has the molecular formula C18H31NO4S and a molecular weight of 357.52 g/mol. Its IUPAC name is N-[3-(2-ethylhexoxy)propyl]-4-methoxybenzenesulfonamide.
| Compound Name | N-[3-(2-ethylhexoxy)propyl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 3432090 |
| Molecular Formula | C18H31NO4S |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | N-[3-(2-ethylhexoxy)propyl]-4-methoxybenzenesulfonamide |
| SMILES | CCCCC(CC)COCCCNS(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H31NO4S/c1-4-6-8-16(5-2)15-23-14-7-13-19-24(20,21)18-11-9-17(22-3)10-12-18/h9-12,16,19H,4-8,13-15H2,1-3H3 |
| InChIKey | SYXFXQGRAFJXGY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|