About N-[4-(chloromethyl)-5-(3-methylphenyl)-1,3-thiazol-2-yl]-2,6-difluorobenzamide
N-[4-(chloromethyl)-5-(3-methylphenyl)-1,3-thiazol-2-yl]-2,6-difluorobenzamide (PubChem CID 90145517) has the molecular formula C18H13ClF2N2OS
and a molecular weight of 378.83 g/mol. Its IUPAC name is N-[4-(chloromethyl)-5-(3-methylphenyl)-1,3-thiazol-2-yl]-2,6-difluorobenzamide.
Molecular Properties
| Compound Name | N-[4-(chloromethyl)-5-(3-methylphenyl)-1,3-thiazol-2-yl]-2,6-difluorobenzamide |
| PubChem CID | 90145517 |
| Molecular Formula | C18H13ClF2N2OS |
| Molecular Weight | 378.83 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | N-[4-(chloromethyl)-5-(3-methylphenyl)-1,3-thiazol-2-yl]-2,6-difluorobenzamide |
| SMILES | Cc1cccc(-c2sc(NC(=O)c3c(F)cccc3F)nc2CCl)c1 |
| InChI | InChI=1S/C18H13ClF2N2OS/c1-10-4-2-5-11(8-10)16-14(9-19)22-18(25-16)23-17(24)15-12(20)6-3-7-13(15)21/h2-8H,9H2,1H3,(H,22,23,24) |
| InChIKey | NQRZGGUIOKWZTF-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.83 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(chloromethyl)-5-(3-methylphenyl)-1,3-thiazol-2-yl]-2,6-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(chloromethyl)-5-(3-methylphenyl)-1,3-thiazol-2-yl]-2,6-difluorobenzamide?
The IUPAC name of N-[4-(chloromethyl)-5-(3-methylphenyl)-1,3-thiazol-2-yl]-2,6-difluorobenzamide (CID 90145517) is N-[4-(chloromethyl)-5-(3-methylphenyl)-1,3-thiazol-2-yl]-2,6-difluorobenzamide.
What is the SMILES notation for N-[4-(chloromethyl)-5-(3-methylphenyl)-1,3-thiazol-2-yl]-2,6-difluorobenzamide?
The canonical SMILES for N-[4-(chloromethyl)-5-(3-methylphenyl)-1,3-thiazol-2-yl]-2,6-difluorobenzamide is Cc1cccc(-c2sc(NC(=O)c3c(F)cccc3F)nc2CCl)c1.
What is the InChIKey of N-[4-(chloromethyl)-5-(3-methylphenyl)-1,3-thiazol-2-yl]-2,6-difluorobenzamide?
The InChIKey is NQRZGGUIOKWZTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13ClF2N2OS/c1-10-4-2-5-11(8-10)16-14(9-19)22-18(25-16)23-17(24)15-12(20)6-3-7-13(15)21/h2-8H,9H2,1H3,(H,22,23,24).
What are the key properties of N-[4-(chloromethyl)-5-(3-methylphenyl)-1,3-thiazol-2-yl]-2,6-difluorobenzamide?
N-[4-(chloromethyl)-5-(3-methylphenyl)-1,3-thiazol-2-yl]-2,6-difluorobenzamide has a molecular weight of 378.83 g/mol, XLogP of 5.39, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(chloromethyl)-5-(3-methylphenyl)-1,3-thiazol-2-yl]-2,6-difluorobenzamide is sourced from PubChem (CID 90145517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).