C18H13ClF2N2OS — CID 90145517
N-[4-(chloromethyl)-5-(3-methylphenyl)-1,3-thiazol-2-yl]-2,6-difluorobenzamide (PubChem CID 90145517) has the molecular formula C18H13ClF2N2OS and a molecular weight of 378.83 g/mol. Its IUPAC name is N-[4-(chloromethyl)-5-(3-methylphenyl)-1,3-thiazol-2-yl]-2,6-difluorobenzamide.
| Compound Name | N-[4-(chloromethyl)-5-(3-methylphenyl)-1,3-thiazol-2-yl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 90145517 |
| Molecular Formula | C18H13ClF2N2OS |
| Molecular Weight | 378.83 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | N-[4-(chloromethyl)-5-(3-methylphenyl)-1,3-thiazol-2-yl]-2,6-difluorobenzamide |
| SMILES | Cc1cccc(-c2sc(NC(=O)c3c(F)cccc3F)nc2CCl)c1 |
| InChI | InChI=1S/C18H13ClF2N2OS/c1-10-4-2-5-11(8-10)16-14(9-19)22-18(25-16)23-17(24)15-12(20)6-3-7-13(15)21/h2-8H,9H2,1H3,(H,22,23,24) |
| InChIKey | NQRZGGUIOKWZTF-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.83 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|