C24H26N8O3 — CID 90148365
1-[1-(2-aminoethyl)piperidin-4-yl]-3-(3-nitro-4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 90148365) has the molecular formula C24H26N8O3 and a molecular weight of 474.53 g/mol. Its IUPAC name is 1-[1-(2-aminoethyl)piperidin-4-yl]-3-(3-nitro-4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 1-[1-(2-aminoethyl)piperidin-4-yl]-3-(3-nitro-4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 90148365 |
| Molecular Formula | C24H26N8O3 |
| Molecular Weight | 474.53 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | 1-[1-(2-aminoethyl)piperidin-4-yl]-3-(3-nitro-4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | NCCN1CCC(n2nc(-c3ccc(Oc4ccccc4)c([N+](=O)[O-])c3)c3c(N)ncnc32)CC1 |
| InChI | InChI=1S/C24H26N8O3/c25-10-13-30-11-8-17(9-12-30)31-24-21(23(26)27-15-28-24)22(29-31)16-6-7-20(19(14-16)32(33)34)35-18-4-2-1-3-5-18/h1-7,14-15,17H,8-13,25H2,(H2,26,27,28) |
| InChIKey | ZYJDAFOTGSMSQR-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 151.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.53 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|