C41H39N9O7 — CID 170158541
(4-nitrophenyl) 4-[[4-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]methyl]-2-(4-nitrophenyl)piperidine-1-carboxylate (PubChem CID 170158541) has the molecular formula C41H39N9O7 and a molecular weight of 769.82 g/mol. Its IUPAC name is (4-nitrophenyl) 4-[[4-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]methyl]-2-(4-nitrophenyl)piperidine-1-carboxylate.
| Compound Name | (4-nitrophenyl) 4-[[4-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]methyl]-2-(4-nitrophenyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 170158541 |
| Molecular Formula | C41H39N9O7 |
| Molecular Weight | 769.82 g/mol |
| Exact Mass | 769.30 |
| IUPAC Name | (4-nitrophenyl) 4-[[4-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]methyl]-2-(4-nitrophenyl)piperidine-1-carboxylate |
| SMILES | Nc1ncnc2c1c(-c1ccc(Oc3ccccc3)cc1)nn2C1CCN(CC2CCN(C(=O)Oc3ccc([N+](=O)[O-])cc3)C(c3ccc([N+](=O)[O-])cc3)C2)CC1 |
| InChI | InChI=1S/C41H39N9O7/c42-39-37-38(29-8-14-34(15-9-29)56-33-4-2-1-3-5-33)45-48(40(37)44-26-43-39)30-19-21-46(22-20-30)25-27-18-23-47(36(24-27)28-6-10-31(11-7-28)49(52)53)41(51)57-35-16-12-32(13-17-35)50(54)55/h1-17,26-27,30,36H,18-25H2,(H2,42,43,44) |
| InChIKey | GWKJLYFDKWFWSU-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 197.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.82 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|