C30H33NO11 — CID 90148890
[(1R,2R,3S,5S)-5-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-2-hydroxy-3-(hydroxymethyl)-5-(pyrrolidine-1-carbonyl)cyclohexyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate (PubChem CID 90148890) has the molecular formula C30H33NO11 and a molecular weight of 583.59 g/mol. Its IUPAC name is [(1R,2R,3S,5S)-5-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-2-hydroxy-3-(hydroxymethyl)-5-(pyrrolidine-1-carbonyl)cyclohexyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate.
| Compound Name | [(1R,2R,3S,5S)-5-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-2-hydroxy-3-(hydroxymethyl)-5-(pyrrolidine-1-carbonyl)cyclohexyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 90148890 |
| Molecular Formula | C30H33NO11 |
| Molecular Weight | 583.59 g/mol |
| Exact Mass | 583.21 |
| IUPAC Name | [(1R,2R,3S,5S)-5-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-2-hydroxy-3-(hydroxymethyl)-5-(pyrrolidine-1-carbonyl)cyclohexyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)O[C@@H]1C[C@](OC(=O)/C=C/c2ccc(O)c(O)c2)(C(=O)N2CCCC2)C[C@@H](CO)[C@H]1O |
| InChI | InChI=1S/C30H33NO11/c32-17-20-15-30(29(40)31-11-1-2-12-31,42-27(38)10-6-19-4-8-22(34)24(36)14-19)16-25(28(20)39)41-26(37)9-5-18-3-7-21(33)23(35)13-18/h3-10,13-14,20,25,28,32-36,39H,1-2,11-12,15-17H2/b9-5+,10-6+/t20-,25+,28+,30-/m0/s1 |
| InChIKey | QXWAVFIKDRRTHH-FWDIEJQISA-N |
| XLogP | 1.82 |
| TPSA | 194.29 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.59 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|