C29H31NO11 — CID 91600056
[(1R,3R,5R)-2-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-3,5-dihydroxy-5-(pyrrolidine-1-carbonyl)cyclohexyl] 3-(3,4-dihydroxyphenyl)prop-2-enoate (PubChem CID 91600056) has the molecular formula C29H31NO11 and a molecular weight of 569.56 g/mol. Its IUPAC name is [(1R,3R,5R)-2-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-3,5-dihydroxy-5-(pyrrolidine-1-carbonyl)cyclohexyl] 3-(3,4-dihydroxyphenyl)prop-2-enoate.
| Compound Name | [(1R,3R,5R)-2-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-3,5-dihydroxy-5-(pyrrolidine-1-carbonyl)cyclohexyl] 3-(3,4-dihydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 91600056 |
| Molecular Formula | C29H31NO11 |
| Molecular Weight | 569.56 g/mol |
| Exact Mass | 569.19 |
| IUPAC Name | [(1R,3R,5R)-2-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-3,5-dihydroxy-5-(pyrrolidine-1-carbonyl)cyclohexyl] 3-(3,4-dihydroxyphenyl)prop-2-enoate |
| SMILES | O=C(C=Cc1ccc(O)c(O)c1)OC1[C@H](O)C[C@](O)(C(=O)N2CCCC2)C[C@H]1OC(=O)C=Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C29H31NO11/c31-19-7-3-17(13-21(19)33)5-9-25(36)40-24-16-29(39,28(38)30-11-1-2-12-30)15-23(35)27(24)41-26(37)10-6-18-4-8-20(32)22(34)14-18/h3-10,13-14,23-24,27,31-35,39H,1-2,11-12,15-16H2/t23-,24-,27?,29-/m1/s1 |
| InChIKey | XLNFORWVRUFCAM-SKMQWACXSA-N |
| XLogP | 1.57 |
| TPSA | 194.29 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.56 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|