C30H33INO9- — CID 145480856
[(3R,5R)-3,5-dihydroxy-2-[(E)-3-(3-methylphenyl)prop-2-enoyl]oxyiodanuidyl-5-(pyrrolidine-1-carbonyl)cyclohexyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate (PubChem CID 145480856) has the molecular formula C30H33INO9- and a molecular weight of 678.50 g/mol. Its IUPAC name is [(3R,5R)-3,5-dihydroxy-2-[(E)-3-(3-methylphenyl)prop-2-enoyl]oxyiodanuidyl-5-(pyrrolidine-1-carbonyl)cyclohexyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate.
| Compound Name | [(3R,5R)-3,5-dihydroxy-2-[(E)-3-(3-methylphenyl)prop-2-enoyl]oxyiodanuidyl-5-(pyrrolidine-1-carbonyl)cyclohexyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 145480856 |
| Molecular Formula | C30H33INO9- |
| Molecular Weight | 678.50 g/mol |
| Exact Mass | 678.12 |
| IUPAC Name | [(3R,5R)-3,5-dihydroxy-2-[(E)-3-(3-methylphenyl)prop-2-enoyl]oxyiodanuidyl-5-(pyrrolidine-1-carbonyl)cyclohexyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| SMILES | Cc1cccc(/C=C/C(=O)O[I-]C2C(OC(=O)/C=C/c3ccc(O)c(O)c3)C[C@@](O)(C(=O)N3CCCC3)C[C@H]2O)c1 |
| InChI | InChI=1S/C30H33INO9/c1-19-5-4-6-20(15-19)9-12-27(37)41-31-28-24(35)17-30(39,29(38)32-13-2-3-14-32)18-25(28)40-26(36)11-8-21-7-10-22(33)23(34)16-21/h4-12,15-16,24-25,28,33-35,39H,2-3,13-14,17-18H2,1H3/q-1/b11-8+,12-9+/t24-,25?,28?,30-/m1/s1 |
| InChIKey | SVLUVKBQMPSZBG-SZYDWTKISA-N |
| XLogP | -0.53 |
| TPSA | 153.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.50 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|