C21H25N3O4 — CID 90149641
tert-butyl N-[2-[(6-amino-9-oxoxanthen-3-yl)-methylamino]ethyl]carbamate (PubChem CID 90149641) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is tert-butyl N-[2-[(6-amino-9-oxoxanthen-3-yl)-methylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(6-amino-9-oxoxanthen-3-yl)-methylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 90149641 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | tert-butyl N-[2-[(6-amino-9-oxoxanthen-3-yl)-methylamino]ethyl]carbamate |
| SMILES | CN(CCNC(=O)OC(C)(C)C)c1ccc2c(=O)c3ccc(N)cc3oc2c1 |
| InChI | InChI=1S/C21H25N3O4/c1-21(2,3)28-20(26)23-9-10-24(4)14-6-8-16-18(12-14)27-17-11-13(22)5-7-15(17)19(16)25/h5-8,11-12H,9-10,22H2,1-4H3,(H,23,26) |
| InChIKey | QLHMYBZRUPYJFE-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 97.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|