C20H25Cl2NO — CID 90150517
1-[2-[[2-(4-chlorophenyl)phenyl]methoxy]ethyl]piperidine;hydrochloride (PubChem CID 90150517) has the molecular formula C20H25Cl2NO and a molecular weight of 366.33 g/mol. Its IUPAC name is 1-[2-[[2-(4-chlorophenyl)phenyl]methoxy]ethyl]piperidine;hydrochloride.
| Compound Name | 1-[2-[[2-(4-chlorophenyl)phenyl]methoxy]ethyl]piperidine;hydrochloride |
|---|---|
| PubChem CID | 90150517 |
| Molecular Formula | C20H25Cl2NO |
| Molecular Weight | 366.33 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 1-[2-[[2-(4-chlorophenyl)phenyl]methoxy]ethyl]piperidine;hydrochloride |
| SMILES | Cl.Clc1ccc(-c2ccccc2COCCN2CCCCC2)cc1 |
| InChI | InChI=1S/C20H24ClNO.ClH/c21-19-10-8-17(9-11-19)20-7-3-2-6-18(20)16-23-15-14-22-12-4-1-5-13-22;/h2-3,6-11H,1,4-5,12-16H2;1H |
| InChIKey | GHZHBWJGFNGTMJ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.33 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|