C24H24Cl3NOS2 — CID 10185984
1-[2-[(16,17-dichloro-3,13-dithiatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),4,7,9,11,14,16-octaen-4-yl)methoxy]ethyl]piperidine;hydrochloride (PubChem CID 10185984) has the molecular formula C24H24Cl3NOS2 and a molecular weight of 512.96 g/mol. Its IUPAC name is 1-[2-[(16,17-dichloro-3,13-dithiatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),4,7,9,11,14,16-octaen-4-yl)methoxy]ethyl]piperidine;hydrochloride.
| Compound Name | 1-[2-[(16,17-dichloro-3,13-dithiatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),4,7,9,11,14,16-octaen-4-yl)methoxy]ethyl]piperidine;hydrochloride |
|---|---|
| PubChem CID | 10185984 |
| Molecular Formula | C24H24Cl3NOS2 |
| Molecular Weight | 512.96 g/mol |
| Exact Mass | 511.04 |
| IUPAC Name | 1-[2-[(16,17-dichloro-3,13-dithiatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),4,7,9,11,14,16-octaen-4-yl)methoxy]ethyl]piperidine;hydrochloride |
| SMILES | Cl.Clc1cc2c(cc1Cl)-c1sc(COCCN3CCCCC3)cc1-c1ccccc1S2 |
| InChI | InChI=1S/C24H23Cl2NOS2.ClH/c25-20-13-19-23(14-21(20)26)30-22-7-3-2-6-17(22)18-12-16(29-24(18)19)15-28-11-10-27-8-4-1-5-9-27;/h2-3,6-7,12-14H,1,4-5,8-11,15H2;1H |
| InChIKey | YOMHCNGUHZWGDV-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.96 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|