C20H30N8 — CID 90158094
N-(1-tert-butylpyrrolidin-3-yl)-8-(1-ethyl-5-methylpyrazol-4-yl)-9-methylpurin-6-amine (PubChem CID 90158094) has the molecular formula C20H30N8 and a molecular weight of 382.52 g/mol. Its IUPAC name is N-(1-tert-butylpyrrolidin-3-yl)-8-(1-ethyl-5-methylpyrazol-4-yl)-9-methylpurin-6-amine.
| Compound Name | N-(1-tert-butylpyrrolidin-3-yl)-8-(1-ethyl-5-methylpyrazol-4-yl)-9-methylpurin-6-amine |
|---|---|
| PubChem CID | 90158094 |
| Molecular Formula | C20H30N8 |
| Molecular Weight | 382.52 g/mol |
| Exact Mass | 382.26 |
| IUPAC Name | N-(1-tert-butylpyrrolidin-3-yl)-8-(1-ethyl-5-methylpyrazol-4-yl)-9-methylpurin-6-amine |
| SMILES | CCn1ncc(-c2nc3c(NC4CCN(C(C)(C)C)C4)ncnc3n2C)c1C |
| InChI | InChI=1S/C20H30N8/c1-7-28-13(2)15(10-23-28)18-25-16-17(21-12-22-19(16)26(18)6)24-14-8-9-27(11-14)20(3,4)5/h10,12,14H,7-9,11H2,1-6H3,(H,21,22,24) |
| InChIKey | FGFVNOBNDREEBD-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 76.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.52 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |